Products 1803598-06-2

CAS 1803598-06-2 is the registry number for 2-Fluoro-6-hydroxy-4-methylphenylboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.

Structural formula: {0} (CAS {1})

(2-fluoro-6-hydroxy-4-methylphenyl)boronic acid (CAS 1803598-06-2) is a chemical compound with the molecular formula C7H8BFO3 and a molecular weight of 169.95 g/mol. IUPAC name: (2-fluoro-6-hydroxy-4-methylphenyl)boronic acid. InChIKey: BFXMHIMQAMDQQX-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8BFO3
Molecular weight169.95 g/mol
IUPAC name(2-fluoro-6-hydroxy-4-methylphenyl)boronic acid
InChIKeyBFXMHIMQAMDQQX-UHFFFAOYSA-N
SMILESB(C1=C(C=C(C=C1F)C)O)(O)O

Computed by PubChem (NCBI)