CAS 1246633-55-5 appears in our catalog under these names: 3-Fluoro-2-(hydroxymethyl)phenylboronic acid, 98%, (3–Fluoro–2–(hydroxymethyl)phenyl)boronic acid, (3-Fluoro-2-(hydroxymethyl)phenyl)boronic acid 97%, (3-Fluoro-2-(hydroxymethyl)phenyl)boronic acid, 97%, 97%, (3-Fluoro-2-(hydroxymethyl)phenyl)boronic acid, ≥98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100g, 25g, 5g, 10g, 250mg.
[3-fluoro-2-(hydroxymethyl)phenyl]boronic acid (CAS 1246633-55-5) is a chemical compound with the molecular formula C7H8BFO3 and a molecular weight of 169.95 g/mol. IUPAC name: [3-fluoro-2-(hydroxymethyl)phenyl]boronic acid. InChIKey: FNZUUOCXJIJMBF-UHFFFAOYSA-N.
| Molecular formula | C7H8BFO3 |
|---|---|
| Molecular weight | 169.95 g/mol |
| IUPAC name | [3-fluoro-2-(hydroxymethyl)phenyl]boronic acid |
| InChIKey | FNZUUOCXJIJMBF-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)F)CO)(O)O |
Computed by PubChem (NCBI)