cas: 955374-17-1 — see every product listed under this CAS number, including other names
(2-Fluoro-6-morpholinopyridin-3-yl)boronic acid, 95%, 95% (CAS 955374-17-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FKZR-250mg |
| cas | 955374-17-1 |
| size | 250mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 1163.60 Pln | |
| Chemat | 1g | 2474.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2-fluoro-6-morpholin-4-yl-3-pyridinyl)boronic acid (CAS 955374-17-1) is a chemical compound with the molecular formula C9H12BFN2O3 and a molecular weight of 226.01 g/mol. IUPAC name: (2-fluoro-6-morpholin-4-yl-3-pyridinyl)boronic acid. InChIKey: PUIOCXIPPAMHSB-UHFFFAOYSA-N.
| Molecular formula | C9H12BFN2O3 |
|---|---|
| Molecular weight | 226.01 g/mol |
| IUPAC name | (2-fluoro-6-morpholin-4-yl-3-pyridinyl)boronic acid |
| InChIKey | PUIOCXIPPAMHSB-UHFFFAOYSA-N |
| SMILES | B(C1=C(N=C(C=C1)N2CCOCC2)F)(O)O |
Computed by PubChem (NCBI)