Products 1256355-28-8

CAS 1256355-28-8 is the registry number for 3-Fluoro-2-morpholinopyridine-4-boronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

(3-fluoro-2-morpholin-4-yl-4-pyridinyl)boronic acid (CAS 1256355-28-8) is a chemical compound with the molecular formula C9H12BFN2O3 and a molecular weight of 226.01 g/mol. IUPAC name: (3-fluoro-2-morpholin-4-yl-4-pyridinyl)boronic acid. InChIKey: KKEINPUABSQWEE-UHFFFAOYSA-N.

Identity
Molecular formulaC9H12BFN2O3
Molecular weight226.01 g/mol
IUPAC name(3-fluoro-2-morpholin-4-yl-4-pyridinyl)boronic acid
InChIKeyKKEINPUABSQWEE-UHFFFAOYSA-N
SMILESB(C1=C(C(=NC=C1)N2CCOCC2)F)(O)O

Computed by PubChem (NCBI)