CAS 955374-17-1 appears in our catalog under these names: [2-fluoro-6-(morpholin-4-yl)pyridin-3-yl]boronic acid, 95%, (2–fluoro–6–morpholinopyridin–3–yl)boronic acid, (2-Fluoro-6-morpholinopyridin-3-yl)boronic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 50mg.
(2-fluoro-6-morpholin-4-yl-3-pyridinyl)boronic acid (CAS 955374-17-1) is a chemical compound with the molecular formula C9H12BFN2O3 and a molecular weight of 226.01 g/mol. IUPAC name: (2-fluoro-6-morpholin-4-yl-3-pyridinyl)boronic acid. InChIKey: PUIOCXIPPAMHSB-UHFFFAOYSA-N.
| Molecular formula | C9H12BFN2O3 |
|---|---|
| Molecular weight | 226.01 g/mol |
| IUPAC name | (2-fluoro-6-morpholin-4-yl-3-pyridinyl)boronic acid |
| InChIKey | PUIOCXIPPAMHSB-UHFFFAOYSA-N |
| SMILES | B(C1=C(N=C(C=C1)N2CCOCC2)F)(O)O |
Computed by PubChem (NCBI)