cas: 869735-25-1 — see every product listed under this CAS number, including other names
(2-Iodo-pyridin-4-yl)-carbamic acid tert-butyl ester, 97% (CAS 869735-25-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F636298-100MG |
| cas | 869735-25-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 482.14 Pln | |
| Fluorochem | 250mg | 888.25 Pln | |
| Fluorochem | 500mg | 1726.49 Pln | |
| Fluorochem | 1g | 2346.07 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-(2-iodo-4-pyridinyl)carbamate (CAS 869735-25-1) is a chemical compound with the molecular formula C10H13IN2O2 and a molecular weight of 320.13 g/mol. IUPAC name: tert-butyl N-(2-iodo-4-pyridinyl)carbamate. InChIKey: PUTKGLACVBDVLW-UHFFFAOYSA-N.
| Molecular formula | C10H13IN2O2 |
|---|---|
| Molecular weight | 320.13 g/mol |
| IUPAC name | tert-butyl N-(2-iodo-4-pyridinyl)carbamate |
| InChIKey | PUTKGLACVBDVLW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC(=NC=C1)I |
Computed by PubChem (NCBI)