Products 849830-17-7

CAS 849830-17-7 is the registry number for (6-Iodo-pyridin-2-yl)-carbamic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Tert-butyl N-(6-iodo-2-pyridinyl)carbamate (CAS 849830-17-7) is a chemical compound with the molecular formula C10H13IN2O2 and a molecular weight of 320.13 g/mol. IUPAC name: tert-butyl N-(6-iodo-2-pyridinyl)carbamate. InChIKey: FNFCSNUZLDAMEG-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13IN2O2
Molecular weight320.13 g/mol
IUPAC nametert-butyl N-(6-iodo-2-pyridinyl)carbamate
InChIKeyFNFCSNUZLDAMEG-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC1=NC(=CC=C1)I

Computed by PubChem (NCBI)