CAS 869735-25-1 appears in our catalog under these names: (2-Iodo-pyridin-4-yl)-carbamic acid tert-butyl ester, 95%, tert–Butyl (2–iodopyridin–4–yl)carbamate, 1,1-Dimethylethyl N-(2-iodo-4-pyridinyl)carbamate, 97%, 97%, (2-Iodo-pyridin-4-yl)-carbamic acid tert-butyl ester, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 100mg, 250mg, 500mg.
Tert-butyl N-(2-iodo-4-pyridinyl)carbamate (CAS 869735-25-1) is a chemical compound with the molecular formula C10H13IN2O2 and a molecular weight of 320.13 g/mol. IUPAC name: tert-butyl N-(2-iodo-4-pyridinyl)carbamate. InChIKey: PUTKGLACVBDVLW-UHFFFAOYSA-N.
| Molecular formula | C10H13IN2O2 |
|---|---|
| Molecular weight | 320.13 g/mol |
| IUPAC name | tert-butyl N-(2-iodo-4-pyridinyl)carbamate |
| InChIKey | PUTKGLACVBDVLW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC(=NC=C1)I |
Computed by PubChem (NCBI)