CAS 677746-35-9 appears in our catalog under these names: (2-Methoxy-5-nitrophenyl)boronic acid, (2-Methoxy-5-nitrophenyl)boronic acid, 98%, 98%, (2-Methoxy-5-nitrophenyl)boronic acid, 98%. Offered by: Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 0,5g, 5g, 250mg, 1g.
(2-methoxy-5-nitrophenyl)boronic acid (CAS 677746-35-9) is a chemical compound with the molecular formula C7H8BNO5 and a molecular weight of 196.96 g/mol. IUPAC name: (2-methoxy-5-nitrophenyl)boronic acid. InChIKey: CCKCSFVTRYBXAW-UHFFFAOYSA-N.
| Molecular formula | C7H8BNO5 |
|---|---|
| Molecular weight | 196.96 g/mol |
| IUPAC name | (2-methoxy-5-nitrophenyl)boronic acid |
| InChIKey | CCKCSFVTRYBXAW-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)[N+](=O)[O-])OC)(O)O |
Computed by PubChem (NCBI)