CAS 827614-67-5 appears in our catalog under these names: 4–Methoxy–3–nitrophenylboronic acid, 4-Methoxy-3-nitrobenzeneboronic acid, 4-Methoxy-3-nitrophenylboronic acid 98%, 4-Methoxy-3-nitrophenylboronic acid, 98%, 98%, 4-Methoxy-3-nitrophenylboronic acid, 97%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg.
(4-methoxy-3-nitrophenyl)boronic acid (CAS 827614-67-5) is a chemical compound with the molecular formula C7H8BNO5 and a molecular weight of 196.96 g/mol. IUPAC name: (4-methoxy-3-nitrophenyl)boronic acid. InChIKey: HAQVJQNWHRUPBH-UHFFFAOYSA-N.
| Molecular formula | C7H8BNO5 |
|---|---|
| Molecular weight | 196.96 g/mol |
| IUPAC name | (4-methoxy-3-nitrophenyl)boronic acid |
| InChIKey | HAQVJQNWHRUPBH-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OC)[N+](=O)[O-])(O)O |
Computed by PubChem (NCBI)