CAS 949892-13-1 appears in our catalog under these names: 2-Methoxy-4-nitrophenylboronic acid, 97%, (2-Methoxy-4-nitrophenyl)boronic acid 95%, 2-METHOXY-4-NITROPHENYLBORONIC ACID, 97%, 97%, (2-Methoxy-4-nitrophenyl)boronic acid, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
(2-methoxy-4-nitrophenyl)boronic acid (CAS 949892-13-1) is a chemical compound with the molecular formula C7H8BNO5 and a molecular weight of 196.96 g/mol. IUPAC name: (2-methoxy-4-nitrophenyl)boronic acid. InChIKey: FUPWIVCAJNLSGK-UHFFFAOYSA-N.
| Molecular formula | C7H8BNO5 |
|---|---|
| Molecular weight | 196.96 g/mol |
| IUPAC name | (2-methoxy-4-nitrophenyl)boronic acid |
| InChIKey | FUPWIVCAJNLSGK-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)[N+](=O)[O-])OC)(O)O |
Computed by PubChem (NCBI)