cas: 114703-81-0 — see every product listed under this CAS number, including other names
(2-Morpholin-4-yl-2-oxo-ethyl)-carbamic acid tert-butyl ester (CAS 114703-81-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F024981-1G |
| cas | 114703-81-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 643.54 Pln | |
| Fluorochem | 5g | 1841.04 Pln |
| delivery time | 2-3 weeks |
|---|
Tert-butyl N-(2-morpholin-4-yl-2-oxoethyl)carbamate (CAS 114703-81-0) is a chemical compound with the molecular formula C11H20N2O4 and a molecular weight of 244.29 g/mol. IUPAC name: tert-butyl N-(2-morpholin-4-yl-2-oxoethyl)carbamate. InChIKey: FFJJMXIKWJWZBQ-UHFFFAOYSA-N.
| Molecular formula | C11H20N2O4 |
|---|---|
| Molecular weight | 244.29 g/mol |
| IUPAC name | tert-butyl N-(2-morpholin-4-yl-2-oxoethyl)carbamate |
| InChIKey | FFJJMXIKWJWZBQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC(=O)N1CCOCC1 |
Computed by PubChem (NCBI)