Products 161521-10-4

CAS 161521-10-4 is the registry number for tert-Butyl N-{1-[methoxy(methyl)carbamoyl]cyclopropyl}carbamate, 96%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl N-[1-[methoxy(methyl)carbamoyl]cyclopropyl]carbamate (CAS 161521-10-4) is a chemical compound with the molecular formula C11H20N2O4 and a molecular weight of 244.29 g/mol. IUPAC name: tert-butyl N-[1-[methoxy(methyl)carbamoyl]cyclopropyl]carbamate. InChIKey: LCWCTOTUCCNHIW-UHFFFAOYSA-N.

Identity
Molecular formulaC11H20N2O4
Molecular weight244.29 g/mol
IUPAC nametert-butyl N-[1-[methoxy(methyl)carbamoyl]cyclopropyl]carbamate
InChIKeyLCWCTOTUCCNHIW-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC1(CC1)C(=O)N(C)OC

Computed by PubChem (NCBI)