CAS 1011479-72-3 appears in our catalog under these names: Ethyl 3–amino–1–Boc–azetidine–3–carboxylate, ETHYL 3-AMINO-1-BOC-AZETIDINE-3-CARBOXYLATE, 1-tert-Butyl 3-ethyl 3-aminoazetidine-1,3-dicarboxylate, 95%, 1-tert-Butyl 3-ethyl 3-aminoazetidine-1,3-dicarboxylate 95%, 1-tert-Butyl 3-ethyl 3-aminoazetidine-1,3-dicarboxylate, 95%, 95%. Offered by: GLPBio, Fluorochem, Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g, 25g.
1-O-tert-butyl 3-O-ethyl 3-aminoazetidine-1,3-dicarboxylate (CAS 1011479-72-3) is a chemical compound with the molecular formula C11H20N2O4 and a molecular weight of 244.29 g/mol. IUPAC name: 1-O-tert-butyl 3-O-ethyl 3-aminoazetidine-1,3-dicarboxylate. InChIKey: MMEIVVYGFADKTL-UHFFFAOYSA-N.
| Molecular formula | C11H20N2O4 |
|---|---|
| Molecular weight | 244.29 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-ethyl 3-aminoazetidine-1,3-dicarboxylate |
| InChIKey | MMEIVVYGFADKTL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(CN(C1)C(=O)OC(C)(C)C)N |
Computed by PubChem (NCBI)