(2-Nitrobenzene-1,3,5-triyl)tricyclohexane, 95%
cas: 40049-67-0 — see every product listed under this CAS number, including other names
(2-Nitrobenzene-1,3,5-triyl)tricyclohexane, 95% (CAS 40049-67-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A2479388-250mg |
| cas | 40049-67-0 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 426.00 Pln | |
| Ambeed | 1g | 1010.06 Pln | |
| Ambeed | 5g | 3374.12 Pln | |
| Chemat | 250mg | 323.60 Pln | |
| Chemat | 1g | 755.60 Pln | |
| Chemat | 5g | 2622.80 Pln | |
| BLDpharm | 250mg | 453.20 Pln | |
| BLDpharm | 1g | 1086.31 Pln | |
| BLDpharm | 5g | 3629.86 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
1,3,5-tricyclohexyl-2-nitrobenzene (CAS 40049-67-0) is a chemical compound with the molecular formula C24H35NO2 and a molecular weight of 369.5 g/mol. IUPAC name: 1,3,5-tricyclohexyl-2-nitrobenzene. InChIKey: KXZNCBGJJMBEJO-UHFFFAOYSA-N.
| Molecular formula | C24H35NO2 |
|---|---|
| Molecular weight | 369.5 g/mol |
| IUPAC name | 1,3,5-tricyclohexyl-2-nitrobenzene |
| InChIKey | KXZNCBGJJMBEJO-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C2=CC(=C(C(=C2)C3CCCCC3)[N+](=O)[O-])C4CCCCC4 |
Computed by PubChem (NCBI)