Products 314035-79-5

CAS 314035-79-5 is the registry number for Antiviral agent 75, 96.88%. Offered by: MedChemExpress. Available pack sizes: 1 mg, 5 mg.

Structural formula: {0} (CAS {1})

1-[4-(1-adamantyl)phenoxy]-3-piperidin-1-ylpropan-2-ol (CAS 314035-79-5) is a chemical compound with the molecular formula C24H35NO2 and a molecular weight of 369.5 g/mol. IUPAC name: 1-[4-(1-adamantyl)phenoxy]-3-piperidin-1-ylpropan-2-ol. InChIKey: TVXMKVJQQHBZPQ-UHFFFAOYSA-N.

Identity
Molecular formulaC24H35NO2
Molecular weight369.5 g/mol
IUPAC name1-[4-(1-adamantyl)phenoxy]-3-piperidin-1-ylpropan-2-ol
InChIKeyTVXMKVJQQHBZPQ-UHFFFAOYSA-N
SMILESC1CCN(CC1)CC(COC2=CC=C(C=C2)C34CC5CC(C3)CC(C5)C4)O

Computed by PubChem (NCBI)