Products 40049-67-0
CAS 40049-67-0 appears in our catalog under these names: (2-Nitrobenzene-1,3,5-triyl)tricyclohexane 95%, (2-Nitrobenzene-1,3,5-triyl)tricyclohexane, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g.
1,3,5-tricyclohexyl-2-nitrobenzene (CAS 40049-67-0) is a chemical compound with the molecular formula C24H35NO2 and a molecular weight of 369.5 g/mol. IUPAC name: 1,3,5-tricyclohexyl-2-nitrobenzene. InChIKey: KXZNCBGJJMBEJO-UHFFFAOYSA-N.
| Molecular formula | C24H35NO2 |
|---|---|
| Molecular weight | 369.5 g/mol |
| IUPAC name | 1,3,5-tricyclohexyl-2-nitrobenzene |
| InChIKey | KXZNCBGJJMBEJO-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C2=CC(=C(C(=C2)C3CCCCC3)[N+](=O)[O-])C4CCCCC4 |
Computed by PubChem (NCBI)