cas: 6125-24-2 — see every product listed under this CAS number, including other names
(2-Nitroethyl)benzene 95% (CAS 6125-24-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A468974-100mg |
| cas | 6125-24-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 398.19 Pln | |
| Ambeed | 5g | 1716.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A468974 |
2-nitroethylbenzene (CAS 6125-24-2) is a chemical compound with the molecular formula C8H9NO2 and a molecular weight of 151.16 g/mol. IUPAC name: 2-nitroethylbenzene. InChIKey: XAWCLWKTUKMCMO-UHFFFAOYSA-N.
| Molecular formula | C8H9NO2 |
|---|---|
| Molecular weight | 151.16 g/mol |
| IUPAC name | 2-nitroethylbenzene |
| InChIKey | XAWCLWKTUKMCMO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC[N+](=O)[O-] |
Computed by PubChem (NCBI)