cas: 6125-24-2 — see every product listed under this CAS number, including other names
(2-Nitroethyl)benzene, 98% (CAS 6125-24-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F240794-250MG |
| cas | 6125-24-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 174.96 Pln | |
| Fluorochem | 1g | 383.22 Pln | |
| Fluorochem | 5g | 1632.78 Pln | |
| Fluorochem | 10g | 2950.02 Pln | |
| Fluorochem | 25g | 7292.24 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2-nitroethylbenzene (CAS 6125-24-2) is a chemical compound with the molecular formula C8H9NO2 and a molecular weight of 151.16 g/mol. IUPAC name: 2-nitroethylbenzene. InChIKey: XAWCLWKTUKMCMO-UHFFFAOYSA-N.
| Molecular formula | C8H9NO2 |
|---|---|
| Molecular weight | 151.16 g/mol |
| IUPAC name | 2-nitroethylbenzene |
| InChIKey | XAWCLWKTUKMCMO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC[N+](=O)[O-] |
Computed by PubChem (NCBI)