cas: 6125-24-2 — see every product listed under this CAS number, including other names
Benzene, (2-nitroethyl)-, 95%, 95% (CAS 6125-24-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11E09T-100mg |
| cas | 6125-24-2 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 318.80 Pln | |
| Chemat | 5g | 1283.60 Pln | |
| Chemat | 10g | 2378.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-nitroethylbenzene (CAS 6125-24-2) is a chemical compound with the molecular formula C8H9NO2 and a molecular weight of 151.16 g/mol. IUPAC name: 2-nitroethylbenzene. InChIKey: XAWCLWKTUKMCMO-UHFFFAOYSA-N.
| Molecular formula | C8H9NO2 |
|---|---|
| Molecular weight | 151.16 g/mol |
| IUPAC name | 2-nitroethylbenzene |
| InChIKey | XAWCLWKTUKMCMO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC[N+](=O)[O-] |
Computed by PubChem (NCBI)