cas: 1016644-38-4 — see every product listed under this CAS number, including other names
(2-Oxo-2,3-dihydrobenzo[d]oxazol-6-yl)boronic acid 96% (CAS 1016644-38-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A214510-100mg |
| cas | 1016644-38-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 259.12 Pln | |
| Ambeed | 250mg | 342.56 Pln | |
| Ambeed | 1g | 1154.69 Pln | |
| Ambeed | 5g | 3869.19 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A214510 |
(2-oxo-3H-1,3-benzoxazol-6-yl)boronic acid (CAS 1016644-38-4) is a chemical compound with the molecular formula C7H6BNO4 and a molecular weight of 178.94 g/mol. IUPAC name: (2-oxo-3H-1,3-benzoxazol-6-yl)boronic acid. InChIKey: PHZVOCDSNUZULP-UHFFFAOYSA-N.
| Molecular formula | C7H6BNO4 |
|---|---|
| Molecular weight | 178.94 g/mol |
| IUPAC name | (2-oxo-3H-1,3-benzoxazol-6-yl)boronic acid |
| InChIKey | PHZVOCDSNUZULP-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)NC(=O)O2)(O)O |
Computed by PubChem (NCBI)