cas: 1016644-38-4 — see every product listed under this CAS number, including other names
(2-Oxo-2,3-dihydrobenzo[d]oxazol-6-yl)boronic acid, 97% (CAS 1016644-38-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F321287-100MG |
| cas | 1016644-38-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 221.81 Pln | |
| Fluorochem | 250mg | 320.74 Pln | |
| Fluorochem | 1g | 1127.75 Pln | |
| Fluorochem | 5g | 3814.30 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(2-oxo-3H-1,3-benzoxazol-6-yl)boronic acid (CAS 1016644-38-4) is a chemical compound with the molecular formula C7H6BNO4 and a molecular weight of 178.94 g/mol. IUPAC name: (2-oxo-3H-1,3-benzoxazol-6-yl)boronic acid. InChIKey: PHZVOCDSNUZULP-UHFFFAOYSA-N.
| Molecular formula | C7H6BNO4 |
|---|---|
| Molecular weight | 178.94 g/mol |
| IUPAC name | (2-oxo-3H-1,3-benzoxazol-6-yl)boronic acid |
| InChIKey | PHZVOCDSNUZULP-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)NC(=O)O2)(O)O |
Computed by PubChem (NCBI)