cas: 525587-00-2 — see every product listed under this CAS number, including other names
(2-Oxo-2-piperazin-1-yl-ethyl)-carbamic acid tert-butyl ester (CAS 525587-00-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F024962-250MG |
| cas | 525587-00-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 414.46 Pln | |
| Fluorochem | 500mg | 643.54 Pln | |
| Fluorochem | 1g | 1028.82 Pln |
| delivery time | 3-4 weeks |
|---|
Tert-butyl N-(2-oxo-2-piperazin-1-ylethyl)carbamate (CAS 525587-00-2) is a chemical compound with the molecular formula C11H21N3O3 and a molecular weight of 243.30 g/mol. IUPAC name: tert-butyl N-(2-oxo-2-piperazin-1-ylethyl)carbamate. InChIKey: PVPLWNKSNCRQIL-UHFFFAOYSA-N.
| Molecular formula | C11H21N3O3 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | tert-butyl N-(2-oxo-2-piperazin-1-ylethyl)carbamate |
| InChIKey | PVPLWNKSNCRQIL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC(=O)N1CCNCC1 |
Computed by PubChem (NCBI)