CAS 187834-88-4 appears in our catalog under these names: 1-Boc-isonipecotic acid hydrazide, 98%, 1-Boc-isonipecoticacidhydrazide, 97%, 97%, 1-Boc-Isonipecotic acid hydrazide, 97%, 1-Boc-isonipecoticacidhydrazide, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 25g, 5g, 1g, 250mg, 100g.
Tert-butyl 4-(hydrazinecarbonyl)piperidine-1-carboxylate (CAS 187834-88-4) is a chemical compound with the molecular formula C11H21N3O3 and a molecular weight of 243.30 g/mol. IUPAC name: tert-butyl 4-(hydrazinecarbonyl)piperidine-1-carboxylate. InChIKey: JLIKTOWFNQDEME-UHFFFAOYSA-N.
| Molecular formula | C11H21N3O3 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | tert-butyl 4-(hydrazinecarbonyl)piperidine-1-carboxylate |
| InChIKey | JLIKTOWFNQDEME-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)C(=O)NN |
Computed by PubChem (NCBI)