CAS 1002359-83-2 appears in our catalog under these names: (R)-1-Boc-piperidine-3-carboxylic acid hydrazide, 97%, (R)-1-Boc-piperidine-3-carboxylic acid hydrazide, 97%, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 500mg, 5g, 10g, 25g.
Tert-butyl (3R)-3-(hydrazinecarbonyl)piperidine-1-carboxylate (CAS 1002359-83-2) is a chemical compound with the molecular formula C11H21N3O3 and a molecular weight of 243.30 g/mol. IUPAC name: tert-butyl (3R)-3-(hydrazinecarbonyl)piperidine-1-carboxylate. InChIKey: DABYYYLRDBQJTK-MRVPVSSYSA-N.
| Molecular formula | C11H21N3O3 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | tert-butyl (3R)-3-(hydrazinecarbonyl)piperidine-1-carboxylate |
| InChIKey | DABYYYLRDBQJTK-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H](C1)C(=O)NN |
Computed by PubChem (NCBI)