cas: 859485-91-9 — see every product listed under this CAS number, including other names
(2-Phenylthiazol-5-yl)methanol 95% (CAS 859485-91-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A895136-100mg |
| cas | 859485-91-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 259.12 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 854.31 Pln | |
| Ambeed | 5g | 2689.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A895136 |
(2-phenyl-1,3-thiazol-5-yl)methanol (CAS 859485-91-9) is a chemical compound with the molecular formula C10H9NOS and a molecular weight of 191.25 g/mol. IUPAC name: (2-phenyl-1,3-thiazol-5-yl)methanol. InChIKey: RTGLBURQTRPWRA-UHFFFAOYSA-N.
| Molecular formula | C10H9NOS |
|---|---|
| Molecular weight | 191.25 g/mol |
| IUPAC name | (2-phenyl-1,3-thiazol-5-yl)methanol |
| InChIKey | RTGLBURQTRPWRA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC=C(S2)CO |
Computed by PubChem (NCBI)