CAS 65384-99-8 appears in our catalog under these names: (4-Phenyl-1,3-thiazol-2-yl)methanol, 95%, (4-Phenylthiazol-2-yl)methanol 95%, (4-Phenylthiazol-2-yl)methanol, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
(4-phenyl-1,3-thiazol-2-yl)methanol (CAS 65384-99-8) is a chemical compound with the molecular formula C10H9NOS and a molecular weight of 191.25 g/mol. IUPAC name: (4-phenyl-1,3-thiazol-2-yl)methanol. InChIKey: TYUWZKSJURGPRJ-UHFFFAOYSA-N.
| Molecular formula | C10H9NOS |
|---|---|
| Molecular weight | 191.25 g/mol |
| IUPAC name | (4-phenyl-1,3-thiazol-2-yl)methanol |
| InChIKey | TYUWZKSJURGPRJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CSC(=N2)CO |
Computed by PubChem (NCBI)