cas: 859485-91-9 — see every product listed under this CAS number, including other names
(2-phenylthiazol-5-yl)Methanol, 95%, 95% (CAS 859485-91-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11H3VJ-100mg |
| cas | 859485-91-9 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 184.40 Pln | |
| Chemat | 250mg | 352.40 Pln | |
| Chemat | 1g | 966.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2-phenyl-1,3-thiazol-5-yl)methanol (CAS 859485-91-9) is a chemical compound with the molecular formula C10H9NOS and a molecular weight of 191.25 g/mol. IUPAC name: (2-phenyl-1,3-thiazol-5-yl)methanol. InChIKey: RTGLBURQTRPWRA-UHFFFAOYSA-N.
| Molecular formula | C10H9NOS |
|---|---|
| Molecular weight | 191.25 g/mol |
| IUPAC name | (2-phenyl-1,3-thiazol-5-yl)methanol |
| InChIKey | RTGLBURQTRPWRA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC=C(S2)CO |
Computed by PubChem (NCBI)