cas: 146140-95-6 — see every product listed under this CAS number, including other names
(2-Pivalamidophenyl)boronic acid 98% (CAS 146140-95-6) is a chemical reagent available from Chemat. Available pack sizes: 10g, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A539137-10g |
| cas | 146140-95-6 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 2122.56 Pln | |
| Ambeed | 250mg | 186.81 Pln | |
| Ambeed | 1g | 359.25 Pln | |
| Ambeed | 5g | 1171.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A539137 |
[2-(2,2-dimethylpropanoylamino)phenyl]boronic acid (CAS 146140-95-6) is a chemical compound with the molecular formula C11H16BNO3 and a molecular weight of 221.06 g/mol. IUPAC name: [2-(2,2-dimethylpropanoylamino)phenyl]boronic acid. InChIKey: MXRAJVMTCAUABO-UHFFFAOYSA-N.
| Molecular formula | C11H16BNO3 |
|---|---|
| Molecular weight | 221.06 g/mol |
| IUPAC name | [2-(2,2-dimethylpropanoylamino)phenyl]boronic acid |
| InChIKey | MXRAJVMTCAUABO-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1NC(=O)C(C)(C)C)(O)O |
Computed by PubChem (NCBI)