cas: 1012341-48-8 — see every product listed under this CAS number, including other names
(2E,4R)-5-[1,1'-Biphenyl]-4-yl-4-[[(1,1-dimethylethoxy)carbonyl]amino]-2-methyl-2-pentenoic acid, 97%, 97% (CAS 1012341-48-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 15g, 25g, 50g, 75g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1102YY-1g |
| cas | 1012341-48-8 |
| size | 1g |
| availability | 800g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 98.00 Pln | |
| Chemat | 10g | 136.40 Pln | |
| Chemat | 15g | 170.00 Pln | |
| Chemat | 25g | 213.20 Pln | |
| Chemat | 50g | 347.60 Pln | |
| Chemat | 75g | 482.00 Pln | |
| Chemat | 100g | 606.80 Pln | |
| Chemat | 200g | 1096.40 Pln | |
| Chemat | 300g | 1595.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(E,4R)-2-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(4-phenylphenyl)pent-2-enoic acid (CAS 1012341-48-8) is a chemical compound with the molecular formula C23H27NO4 and a molecular weight of 381.5 g/mol. IUPAC name: (E,4R)-2-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(4-phenylphenyl)pent-2-enoic acid. InChIKey: JXTNUXJSXXIIFE-VISDOYDDSA-N.
| Molecular formula | C23H27NO4 |
|---|---|
| Molecular weight | 381.5 g/mol |
| IUPAC name | (E,4R)-2-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(4-phenylphenyl)pent-2-enoic acid |
| InChIKey | JXTNUXJSXXIIFE-VISDOYDDSA-N |
| SMILES | C/C(=C\[C@@H](CC1=CC=C(C=C1)C2=CC=CC=C2)NC(=O)OC(C)(C)C)/C(=O)O |
Computed by PubChem (NCBI)