CAS 331763-50-9 appears in our catalog under these names: (4R,5S)-4-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}-5-methylheptanoic acid, 95%, (4R,5S)-Fmoc-4-amino-5-methyl-heptanoic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
(4R,5S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-methylheptanoic acid (CAS 331763-50-9) is a chemical compound with the molecular formula C23H27NO4 and a molecular weight of 381.5 g/mol. IUPAC name: (4R,5S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-methylheptanoic acid. InChIKey: ITDOZAVXEQIJIE-YCRPNKLZSA-N.
| Molecular formula | C23H27NO4 |
|---|---|
| Molecular weight | 381.5 g/mol |
| IUPAC name | (4R,5S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-methylheptanoic acid |
| InChIKey | ITDOZAVXEQIJIE-YCRPNKLZSA-N |
| SMILES | CC[C@H](C)[C@@H](CCC(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)