Products 1820576-32-6
CAS 1820576-32-6 is the registry number for methyl (2S)-2-{[(9H-fluoren-9-ylmethoxy)carbonyl](methyl)amino}-4-methylpentanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-4-methylpentanoate (CAS 1820576-32-6) is a chemical compound with the molecular formula C23H27NO4 and a molecular weight of 381.5 g/mol. IUPAC name: methyl (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-4-methylpentanoate. InChIKey: BXKOQQQQCYZZMH-NRFANRHFSA-N.
| Molecular formula | C23H27NO4 |
|---|---|
| Molecular weight | 381.5 g/mol |
| IUPAC name | methyl (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-4-methylpentanoate |
| InChIKey | BXKOQQQQCYZZMH-NRFANRHFSA-N |
| SMILES | CC(C)C[C@@H](C(=O)OC)N(C)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)