cas: 51019-43-3 — see every product listed under this CAS number, including other names
(2R)-2-(Acetyloxy)-2-phenylacetic acid, 97% (CAS 51019-43-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g, 250g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F094136-10G |
| cas | 51019-43-3 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 10g | 81.24 Pln | |
| Fluorochem | 25g | 107.27 Pln | |
| Fluorochem | 100g | 216.61 Pln | |
| Fluorochem | 250g | 456.11 Pln | |
| Fluorochem | 500g | 794.53 Pln | |
| Fluorochem | 1kg | 1283.94 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(2R)-2-acetyloxy-2-phenylacetic acid (CAS 51019-43-3) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: (2R)-2-acetyloxy-2-phenylacetic acid. InChIKey: OBCUSTCTKLTMBX-SECBINFHSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | (2R)-2-acetyloxy-2-phenylacetic acid |
| InChIKey | OBCUSTCTKLTMBX-SECBINFHSA-N |
| SMILES | CC(=O)O[C@H](C1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)