CAS 14504-07-5 appears in our catalog under these names: 2-(Acetyloxy)-4-methylbenzoic acid, 96%, 2-Acetoxy-4-methylbenzoic acid, 97%, 97%, 2-Acetoxy-4-methylbenzoic acid, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g.
2-acetyloxy-4-methylbenzoic acid (CAS 14504-07-5) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: 2-acetyloxy-4-methylbenzoic acid. InChIKey: TYAIGNOSODVIHJ-UHFFFAOYSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | 2-acetyloxy-4-methylbenzoic acid |
| InChIKey | TYAIGNOSODVIHJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C(=O)O)OC(=O)C |
Computed by PubChem (NCBI)