Products 5438-68-6
CAS 5438-68-6 appears in our catalog under these names: O-Acetyl mandelic acid, 98%, O-Acetyl Mandelic Acid, 2-Acetoxy-2-phenylacetic acid 98%, 2-(2-Acetylphenyl)-2-hydroxyacetic acid, 98%, 98%, O-Acetyl mandelic acid DCHA, 98%. Offered by: Combi-blocks, TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 100g, 100mg, 250mg, 500mg, 10g.
2-acetyloxy-2-phenylacetic acid (CAS 5438-68-6) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: 2-acetyloxy-2-phenylacetic acid. InChIKey: OBCUSTCTKLTMBX-UHFFFAOYSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | 2-acetyloxy-2-phenylacetic acid |
| InChIKey | OBCUSTCTKLTMBX-UHFFFAOYSA-N |
| SMILES | CC(=O)OC(C1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
O-Acetylmandelic acid, O-acetyl mandelic acid, 2-acetyloxy-2-phenylacetic acid, 2-acetoxy-2-phenylacetic acid, 2-Acetyloxy-2-phenyl-acetic acid, (S)-(+)-O-Acetyl-L-mandelic acid, (acetyloxy)(phenyl)acetic acid, (R)-(-)-alpha-Acetoxyphenylacetic acid, 2-acetoxy-2-phenyl-acetic acid, 2-Acetylmandelic acid