cas: 1036959-27-9 — see every product listed under this CAS number, including other names
(2R)-Vildagliptin 99% (CAS 1036959-27-9) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A193613-5mg |
| cas | 1036959-27-9 |
| size | 5mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5mg | 1204.75 Pln | |
| Ambeed | 10mg | 1861.13 Pln | |
| Ambeed | 25mg | 2823.44 Pln | |
| Ambeed | 50mg | 4008.25 Pln | |
| Ambeed | 100mg | 5298.75 Pln | |
| Ambeed | 250mg | 7534.87 Pln |
| purity | 99% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A193613 |
(2R)-1-[2-[(3-hydroxy-1-adamantyl)amino]acetyl]pyrrolidine-2-carbonitrile (CAS 1036959-27-9) is a chemical compound with the molecular formula C17H25N3O2 and a molecular weight of 303.4 g/mol. IUPAC name: (2R)-1-[2-[(3-hydroxy-1-adamantyl)amino]acetyl]pyrrolidine-2-carbonitrile. InChIKey: SYOKIDBDQMKNDQ-JULPFRMLSA-N.
| Molecular formula | C17H25N3O2 |
|---|---|
| Molecular weight | 303.4 g/mol |
| IUPAC name | (2R)-1-[2-[(3-hydroxy-1-adamantyl)amino]acetyl]pyrrolidine-2-carbonitrile |
| InChIKey | SYOKIDBDQMKNDQ-JULPFRMLSA-N |
| SMILES | C1C[C@@H](N(C1)C(=O)CNC23CC4CC(C2)CC(C4)(C3)O)C#N |
Computed by PubChem (NCBI)