CAS 1217546-82-1 appears in our catalog under these names: Vildagliptin-d3, Vildagliptin-d3, >95% (HPLC), Vildagliptin–d3. Offered by: Chemat Brand, Hubei YoungXin, TRC, GLPBio, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 0,5mg, 5mg.
(2S)-2,5,5-trideuterio-1-[2-[[(5S,7R)-3-hydroxy-1-adamantyl]amino]acetyl]pyrrolidine-2-carbonitrile (CAS 1217546-82-1) is a chemical compound with the molecular formula C17H25N3O2 and a molecular weight of 306.42 g/mol. IUPAC name: (2S)-2,5,5-trideuterio-1-[2-[[(5S,7R)-3-hydroxy-1-adamantyl]amino]acetyl]pyrrolidine-2-carbonitrile. InChIKey: SYOKIDBDQMKNDQ-COZVPQRFSA-N.
| Molecular formula | C17H25N3O2 |
|---|---|
| Molecular weight | 306.42 g/mol |
| IUPAC name | (2S)-2,5,5-trideuterio-1-[2-[[(5S,7R)-3-hydroxy-1-adamantyl]amino]acetyl]pyrrolidine-2-carbonitrile |
| InChIKey | SYOKIDBDQMKNDQ-COZVPQRFSA-N |
| SMILES | [2H][C@]1(CCC(N1C(=O)CNC23C[C@H]4C[C@@H](C2)CC(C4)(C3)O)([2H])[2H])C#N |
Computed by PubChem (NCBI)