CAS 1044741-01-6 appears in our catalog under these names: Vildagliptin-13C5,15N, Vildagliptin-13C5,15N, >95% (HPLC), Vildagliptin–13C5,15N. Offered by: Chemat Brand, Hubei YoungXin, TRC, GLPBio, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 2mg.
(2S)-1-[2-[(3-hydroxy-1-adamantyl)amino]acetyl](2,3,4,5-13C4,115N)azolidine-2-carbonitrile (CAS 1044741-01-6) is a chemical compound with the molecular formula C17H25N3O2 and a molecular weight of 309.36 g/mol. IUPAC name: (2S)-1-[2-[(3-hydroxy-1-adamantyl)amino]acetyl](2,3,4,5-13C4,115N)azolidine-2-carbonitrile. InChIKey: SYOKIDBDQMKNDQ-AXHOPKHVSA-N.
| Molecular formula | C17H25N3O2 |
|---|---|
| Molecular weight | 309.36 g/mol |
| IUPAC name | (2S)-1-[2-[(3-hydroxy-1-adamantyl)amino]acetyl](2,3,4,5-13C4,115N)azolidine-2-carbonitrile |
| InChIKey | SYOKIDBDQMKNDQ-AXHOPKHVSA-N |
| SMILES | C1C2CC3(CC1CC(C2)(C3)O)NCC(=O)[15N]4[13CH2][13CH2][13CH2][13C@H]4[13C]#N |
Computed by PubChem (NCBI)