cas: 91604-41-0 — see every product listed under this CAS number, including other names
(2R,3R)-1,4-Bis(benzyloxy)butane-2,3-diol, 98%(LC-MS),RG, 98%(LC-MS),RG (CAS 91604-41-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114BBY-100mg |
| cas | 91604-41-0 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 299.60 Pln | |
| Chemat | 250mg | 486.80 Pln | |
| Chemat | 1g | 707.60 Pln | |
| Chemat | 5g | 2627.60 Pln | |
| Chemat | 25g | 12650.00 Pln |
| purity | 98%(LC-MS),RG |
|---|---|
| delivery time | 3 weeks |
(2R,3R)-1,4-bis(phenylmethoxy)butane-2,3-diol (CAS 91604-41-0) is a chemical compound with the molecular formula C18H22O4 and a molecular weight of 302.4 g/mol. IUPAC name: (2R,3R)-1,4-bis(phenylmethoxy)butane-2,3-diol. InChIKey: YAVAVQDYJARRAU-QZTJIDSGSA-N.
| Molecular formula | C18H22O4 |
|---|---|
| Molecular weight | 302.4 g/mol |
| IUPAC name | (2R,3R)-1,4-bis(phenylmethoxy)butane-2,3-diol |
| InChIKey | YAVAVQDYJARRAU-QZTJIDSGSA-N |
| SMILES | C1=CC=C(C=C1)COC[C@H]([C@@H](COCC2=CC=CC=C2)O)O |
Computed by PubChem (NCBI)