CAS 646053-13-6 appears in our catalog under these names: 6,8-Di-tert-butyl-2-oxo-2H-chromene-3-carboxylic acid, 98%, 2H-1-Benzopyran-3-carboxylic acid, 6,8-bis(1,1-dimethylethyl)-2-oxo-, 97%, 97%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 250mg, 1g, 5g.
6,8-ditert-butyl-2-oxochromene-3-carboxylic acid (CAS 646053-13-6) is a chemical compound with the molecular formula C18H22O4 and a molecular weight of 302.4 g/mol. IUPAC name: 6,8-ditert-butyl-2-oxochromene-3-carboxylic acid. InChIKey: CKSRIRHJQZKLJN-UHFFFAOYSA-N.
| Molecular formula | C18H22O4 |
|---|---|
| Molecular weight | 302.4 g/mol |
| IUPAC name | 6,8-ditert-butyl-2-oxochromene-3-carboxylic acid |
| InChIKey | CKSRIRHJQZKLJN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C2C(=C1)C=C(C(=O)O2)C(=O)O)C(C)(C)C |
Computed by PubChem (NCBI)