CAS 17401-06-8 appears in our catalog under these names: (-)-1,4-Di-o-benzyl-l-threitol, 95%, (–)–1,4–Di–O–benzyl–L–threitol, (-)-1,4-Di-O-benzyl-L-threitol, >98.0%(GC), (2S,3S)-1,4-Bis(benzyloxy)butane-2,3-diol. Offered by: Combi-blocks, GLPBio, TCI, Chemat. Available pack sizes: 5g, 1g, 250mg.
(2S,3S)-1,4-bis(phenylmethoxy)butane-2,3-diol (CAS 17401-06-8) is a chemical compound with the molecular formula C18H22O4 and a molecular weight of 302.4 g/mol. IUPAC name: (2S,3S)-1,4-bis(phenylmethoxy)butane-2,3-diol. InChIKey: YAVAVQDYJARRAU-ROUUACIJSA-N.
| Molecular formula | C18H22O4 |
|---|---|
| Molecular weight | 302.4 g/mol |
| IUPAC name | (2S,3S)-1,4-bis(phenylmethoxy)butane-2,3-diol |
| InChIKey | YAVAVQDYJARRAU-ROUUACIJSA-N |
| SMILES | C1=CC=C(C=C1)COC[C@@H]([C@H](COCC2=CC=CC=C2)O)O |
Computed by PubChem (NCBI)