cas: 492-61-5 — see every product listed under this CAS number, including other names
(2R,3R,4S,5S,6R)-6-(Hydroxymethyl)tetrahydro-2H-pyran-2,3,4,5-tetraol, 85%, 85% (CAS 492-61-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 15g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113X2C-1g |
| cas | 492-61-5 |
| size | 1g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 131.60 Pln | |
| Chemat | 10g | 194.00 Pln | |
| Chemat | 15g | 256.40 Pln | |
| Chemat | 25g | 299.60 Pln | |
| Chemat | 50g | 515.60 Pln | |
| Chemat | 100g | 726.80 Pln |
| purity | 85% |
|---|---|
| delivery time | 3 weeks |
Beta-D-glucose is D-Glucopyranose with beta configuration at the anomeric centre. It has a role as an epitope and a mouse metabolite. It is an enantiomer of a beta-L-glucose.
Source: ChEBI
| Molecular formula | C6H12O6 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | (2R,3R,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
| InChIKey | WQZGKKKJIJFFOK-VFUOTHLCSA-N |
| SMILES | C([C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O)O)O)O)O |
Computed by PubChem (NCBI)