Products 120389-54-0
CAS 120389-54-0 appears in our catalog under these names: Mn(iii) protoporphyrin ix chloride, 95%, Mn(III) Protoporphyrin IX Chloride. Offered by: Combi-blocks, TargetMol, MedChemExpress. Available pack sizes: 250mg, 1g, 100mg, 50mg, 25 mg, 10 mg, 5 mg, 50 mg.
(3R,4S,5S,6R)-6-(hydroxymethyl)(613C)oxane-2,3,4,5-tetrol (CAS 120389-54-0) is a chemical compound with the molecular formula C6H12O6 and a molecular weight of 181.15 g/mol. IUPAC name: (3R,4S,5S,6R)-6-(hydroxymethyl)(613C)oxane-2,3,4,5-tetrol. InChIKey: WQZGKKKJIJFFOK-XCIUHENGSA-N.
| Molecular formula | C6H12O6 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | (3R,4S,5S,6R)-6-(hydroxymethyl)(613C)oxane-2,3,4,5-tetrol |
| InChIKey | WQZGKKKJIJFFOK-XCIUHENGSA-N |
| SMILES | C([13C@@H]1[C@H]([C@@H]([C@H](C(O1)O)O)O)O)O |
Computed by PubChem (NCBI)