CAS 23567-25-1 appears in our catalog under these names: L-(-)-Talose, 95%, L-Talose, 95+%, L-Talose, L–Talose, L-(-)-Talose, >98.0%(HPLC). Offered by: Combi-blocks, AmBeed, TRC, GLPBio, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 50mg, 1000mg, 500mg, 10mg, 5 mg.
Aldehydo-L-talose is the acyclic form of L-talose.
Source: ChEBI
| Molecular formula | C6H12O6 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | (2R,3R,4R,5S)-2,3,4,5,6-pentahydroxyhexanal |
| InChIKey | GZCGUPFRVQAUEE-OMMKOOBNSA-N |
| SMILES | C([C@@H]([C@H]([C@H]([C@H](C=O)O)O)O)O)O |
Computed by PubChem (NCBI)