cas: 73464-50-3 — see every product listed under this CAS number, including other names
(2R,3R,4S,5S,6S)-2-Hydroxy-6-(methoxycarbonyl)tetrahydro-2H-pyran-3,4,5-triyl triacetate, 97%, 97% (CAS 73464-50-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119QXU-100mg |
| cas | 73464-50-3 |
| size | 100mg |
| availability | 100g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 309.20 Pln | |
| Chemat | 250mg | 477.20 Pln | |
| Chemat | 1g | 890.00 Pln | |
| Chemat | 5g | 2128.40 Pln | |
| Chemat | 10g | 3506.00 Pln | |
| Chemat | 25g | 5920.40 Pln | |
| Chemat | 50g | 7365.20 Pln | |
| Chemat | 100g | 13346.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl (2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-hydroxyoxane-2-carboxylate (CAS 73464-50-3) is a chemical compound with the molecular formula C13H18O10 and a molecular weight of 334.28 g/mol. IUPAC name: methyl (2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-hydroxyoxane-2-carboxylate. InChIKey: CLHFNXQWJBTGBL-HKLXJQGRSA-N.
| Molecular formula | C13H18O10 |
|---|---|
| Molecular weight | 334.28 g/mol |
| IUPAC name | methyl (2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-hydroxyoxane-2-carboxylate |
| InChIKey | CLHFNXQWJBTGBL-HKLXJQGRSA-N |
| SMILES | CC(=O)O[C@H]1[C@@H]([C@H](O[C@H]([C@@H]1OC(=O)C)O)C(=O)OC)OC(=O)C |
Computed by PubChem (NCBI)