CAS 73464-50-3 appears in our catalog under these names: 2,3,4-Tri-o-acetyl-beta-d-glucuronic acid methyl ester, 95%, (2R,3R,4S,5S,6S)-2-Hydroxy-6-(methoxycarbonyl)tetrahydro-2H-pyran-3,4,5-triyl triacetate, 98%, 2,3,4-Tri-O-acetyl-β-D-Glucuronide methyl ester, 2,3,4–Tri–O–acetyl–β–D–Glucuronide methyl ester, 2,3,4-Tri-o-acetyl-beta-d-glucuronic acid methyl ester. Offered by: Combi-blocks, AmBeed, TargetMol, GLPBio, Biosynth. Available pack sizes: 5g, 25g, 10g, 1g, 250mg, 100mg, 500mg, 2g.
Methyl (2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-hydroxyoxane-2-carboxylate (CAS 73464-50-3) is a chemical compound with the molecular formula C13H18O10 and a molecular weight of 334.28 g/mol. IUPAC name: methyl (2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-hydroxyoxane-2-carboxylate. InChIKey: CLHFNXQWJBTGBL-HKLXJQGRSA-N.
| Molecular formula | C13H18O10 |
|---|---|
| Molecular weight | 334.28 g/mol |
| IUPAC name | methyl (2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-hydroxyoxane-2-carboxylate |
| InChIKey | CLHFNXQWJBTGBL-HKLXJQGRSA-N |
| SMILES | CC(=O)O[C@H]1[C@@H]([C@H](O[C@H]([C@@H]1OC(=O)C)O)C(=O)OC)OC(=O)C |
Computed by PubChem (NCBI)