CAS 72692-06-9 appears in our catalog under these names: 2,3,4-Tri-O-acetyl-alpha-D-glucuronic acid methyl ester, 96%, 2,3,4-Tri-O-acetyl-D-glucuronic Acid Methyl Ester, (2S,3R,4S,5S,6S)–2–Hydroxy–6–(methoxycarbonyl)tetrahydro–2H–pyran–3,4,5–triyl triacetate, 2,3,4-Tri-O-acetyl-α-D-glucuronic Acid Methyl Ester, 90%, 90%, 2,3,4-Tri-O-acetyl-α-D-glucuronic acid methyl ester, 90.0%. Offered by: Combi-blocks, TRC, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1g, 10g, 5g, 25g, 250mg, 100mg, 250 mg, 100 mg.
Methyl (3S,6R)-3,4,5-triacetyloxy-6-hydroxyoxane-2-carboxylate (CAS 72692-06-9) is a chemical compound with the molecular formula C13H18O10 and a molecular weight of 334.28 g/mol. IUPAC name: methyl (3S,6R)-3,4,5-triacetyloxy-6-hydroxyoxane-2-carboxylate. InChIKey: CLHFNXQWJBTGBL-SHXYABRHSA-N.
| Molecular formula | C13H18O10 |
|---|---|
| Molecular weight | 334.28 g/mol |
| IUPAC name | methyl (3S,6R)-3,4,5-triacetyloxy-6-hydroxyoxane-2-carboxylate |
| InChIKey | CLHFNXQWJBTGBL-SHXYABRHSA-N |
| SMILES | CC(=O)O[C@H]1C(C([C@@H](OC1C(=O)OC)O)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)