cas: 98760-08-8 — see every product listed under this CAS number, including other names
(2R,3S)-3-(tert-Butoxycarbonyl)amino-1,2-epoxy-4-phenylbutane, 98%, 98% (CAS 98760-08-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1143C0-1g |
| cas | 98760-08-8 |
| size | 1g |
| availability | 490g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 83.60 Pln | |
| Chemat | 10g | 98.00 Pln | |
| Chemat | 25g | 150.80 Pln | |
| Chemat | 50g | 208.40 Pln | |
| Chemat | 100g | 290.00 Pln | |
| Chemat | 250g | 602.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[(1S)-1-[(2R)-oxiran-2-yl]-2-phenylethyl]carbamate (CAS 98760-08-8) is a chemical compound with the molecular formula C15H21NO3 and a molecular weight of 263.33 g/mol. IUPAC name: tert-butyl N-[(1S)-1-[(2R)-oxiran-2-yl]-2-phenylethyl]carbamate. InChIKey: NVPOUMXZERMIJK-STQMWFEESA-N.
| Molecular formula | C15H21NO3 |
|---|---|
| Molecular weight | 263.33 g/mol |
| IUPAC name | tert-butyl N-[(1S)-1-[(2R)-oxiran-2-yl]-2-phenylethyl]carbamate |
| InChIKey | NVPOUMXZERMIJK-STQMWFEESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=CC=C1)[C@@H]2CO2 |
Computed by PubChem (NCBI)