CAS 1820580-61-7 is the registry number for cis-1-(4-Methoxybenzyl)-3-methylpiperidine-2-carboxylic acid, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
(2S,3R)-1-[(4-methoxyphenyl)methyl]-3-methylpiperidine-2-carboxylic acid (CAS 1820580-61-7) is a chemical compound with the molecular formula C15H21NO3 and a molecular weight of 263.33 g/mol. IUPAC name: (2S,3R)-1-[(4-methoxyphenyl)methyl]-3-methylpiperidine-2-carboxylic acid. InChIKey: NFOJYQNINUDXGY-RISCZKNCSA-N.
| Molecular formula | C15H21NO3 |
|---|---|
| Molecular weight | 263.33 g/mol |
| IUPAC name | (2S,3R)-1-[(4-methoxyphenyl)methyl]-3-methylpiperidine-2-carboxylic acid |
| InChIKey | NFOJYQNINUDXGY-RISCZKNCSA-N |
| SMILES | C[C@@H]1CCCN([C@@H]1C(=O)O)CC2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)