CAS 156474-22-5 appears in our catalog under these names: Threo-n-boc-d-phenylalanine epoxide, 97%, Atazanavir Impurity 18, Atazanavir Impurity 6, tert–Butyl ((R)–1–((S)–oxiran–2–yl)–2–phenylethyl)carbamate. Offered by: Combi-blocks, Chemat Brand, GLPBio. Available pack sizes: 1g, 250mg, on request, 100mg.
Tert-butyl N-[(1R)-1-[(2S)-oxiran-2-yl]-2-phenylethyl]carbamate (CAS 156474-22-5) is a chemical compound with the molecular formula C15H21NO3 and a molecular weight of 263.33 g/mol. IUPAC name: tert-butyl N-[(1R)-1-[(2S)-oxiran-2-yl]-2-phenylethyl]carbamate. InChIKey: NVPOUMXZERMIJK-CHWSQXEVSA-N.
| Molecular formula | C15H21NO3 |
|---|---|
| Molecular weight | 263.33 g/mol |
| IUPAC name | tert-butyl N-[(1R)-1-[(2S)-oxiran-2-yl]-2-phenylethyl]carbamate |
| InChIKey | NVPOUMXZERMIJK-CHWSQXEVSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CC=CC=C1)[C@H]2CO2 |
Computed by PubChem (NCBI)